D-Fructopyranose diacetonide is a chemical compound used as a pharmaceutical intermediate. It features a polycyclic structure with multiple ether groups and a single alcohol group, commonly employed in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 20880-92-6
Finerenone metabolite M2
Pharmaceutical intermediate for finerenone
Ambroxol Cycloimine Impurity
Pharmaceutical impurity reference standard
Enzalutamide Impurity 56
Pharmaceutical impurity reference standard
3-methyl-5-phenoxy-1(3h)-isobenzofuranone
pharmaceutical intermediate
토피라메이트
active pharmaceutical ingredient
[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methanol
PSSHGMIAIUYOJF-XBWDGYHZSA-N
CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)CO)C