4-[4-(1-adamantyl)phenyl]-2-phenylaniline is a polycyclic aromatic amine compound featuring an adamantyl-substituted biphenyl core. Its structure combines three aromatic rings with a bulky adamantane cage, and it is utilized primarily as a research reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-[4-(1-adamantyl)phenyl]-2-phenylaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
5-(Adamantan-1-yl)-[1,1'-biphenyl]-2-amine
research compound
5-(methylsulfanyl)thiophene-2-carboxylic acid
research compound
4-(4-Cyano-2-methoxyphenyl)-2,8-dimethyl-5-oxo-1,4,5,6-tetrahydro-1,6-naphthyridine-3-carboxamide
pharmaceutical research compound
(4-Bromonaphthalen-1-yl)diphenylphosphine Oxide
research compound
2-{2-[2-(prop-2-yn-1-yloxy)ethoxy]ethoxy}ethan-1-ol
research compound
4-[4-(1-adamantyl)phenyl]-2-phenylaniline
UZAZWEOBCTYWQI-UHFFFAOYSA-N
C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)C5=CC(=C(C=C5)N)C6=CC=CC=C6
4-[4-(1-adamantyl)phenyl]-2-phenylaniline 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.