This compound is a research reagent with a complex polycyclic structure, featuring a benzo[de]isoquinoline-1,3-dione core substituted with a hydroxypropyl group and a trimethylbenzimidazolone moiety. It is primarily used as a research compound for biological studies, as indicated by its availability from chemical suppliers.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2(1H)-Quinolinone, 7-(4-(4-(1,1-dioxidobenzo(b)thien-4-yl)-1-piperazinyl)butoxy)-
Research compound for biological studies
[Rh COD (R)-Binap]BF4
chiral hydrogenation catalyst
5-Bromonicotinic acid
research compound
N-(Furan-2-Ylmethyl)-8-(4-Methylsulfonylphenyl)-[1,2,4]triazolo[4,3-C]pyrimidin-5-Amine
Polycomb repressive complex 2 inhibitor
3-Oxo-3,4-dihydro-2h-pyrazino[2,3-b][1,4]thiazine-6-carbaldehyde
research compound
6-(3-hydroxypropyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione
OFWWWKWUCDUISA-UHFFFAOYSA-N
CC1=CC2=C(C=C1N3C(=O)C4=C5C(=C(C=C4)CCCO)C=CC=C5C3=O)N(C(=O)N2C)C
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.