This compound is a deuterated form of 1-naphthol, where all hydrogen atoms on the naphthalene ring and the hydroxyl group are replaced with deuterium. It is primarily used as a research reference standard in analytical chemistry and stable isotope labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Naphthalen-2,3,4,5,6,7,8-d7-ol-d 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-Phenylethanol-d10
deuterated research reference standard
(O,1,1,1,2,3,3,3-2H8)Propan-2-ol
deuterated research reference standard
Benzene-1,2-d2, 3,4,5,6-tetrachloro-
deuterated research reference standard
1-OCTANE-D17-THIOL
deuterated research reference standard
Sodium taurodeoxycholate hydrate
biochemical research reagent
3,3',5,5'-Tetramethyl(1,1'-biphenyl)-4,4'-diamine--hydrogen chloride--water (1/2/1)
research reagent for peroxidase assays
2,5-dimethoxy-4-ethylthiophenethylamine
psychedelic research compound
3,3'-DIBROMO-5,5'-BIS(TRIMETHYLSILYL)-2,2'-BITHIOPHENE
Organic synthesis building block
1,2,3,4,5,6,7-heptadeuterio-8-deuteriooxynaphthalene
KJCVRFUGPWSIIH-GZORGGLCSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O[2H])[2H])[2H])[2H])[2H])[2H]
1-Naphthalen-2,3,4,5,6,7,8-d7-ol-d 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.