Octadecenedioic acid is a long-chain dicarboxylic acid used primarily as a pharmaceutical intermediate in the manufacturing of active pharmaceutical ingredients. Its structure features two carboxylic acid groups and a single carbon-carbon double bond.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Octadecenedioic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2'-Deoxycytidine hydrate
pharmaceutical intermediate
2'-O,4'-C-Methyleneguanosine
pharmaceutical intermediate for nucleoside analogs
Fmoc-Ala-OH H2O
Fmoc-protected amino acid for peptide synthesis
4-(Cbz-amino)piperidine Hydrochloride
Pharmaceutical intermediate
(Z)-octadec-9-enedioic acid
SBLKVIQSIHEQOF-UPHRSURJSA-N
C(CCC/C=C\CCCCCCCC(=O)O)CCCC(=O)O
Octadecenedioic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.