This compound is a research reagent featuring a dioxane ring with multiple ester functional groups. It is primarily used as a chemical intermediate for laboratory-scale synthesis and investigation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
D-4-Methoxymandelic acid
research compound
3-Ethynylaniline hydrochloride
research chemical
Saikosaponin-C
phytochemical reference standard
Mesityl-d10 oxide
isotopically labeled research compound
Ethyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
2,2,5-Trimethyl-1,3-dioxane-4,6-dione
Pharmaceutical intermediate
1,3-Dioxane-5-propanoic acid, 2,2-dimethyl-4,6-dioxo-, methyl ester
n.a
ethyl 3-[5-(3-ethoxy-3-oxopropyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl]propanoate
VBRYYLKXUUYJJE-UHFFFAOYSA-N
CCOC(=O)CCC1(C(=O)OC(OC1=O)(C)C)CCC(=O)OCC
—
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.