2-Butene-1,4-diyl bis(bromoacetate) is a chemical compound containing ester and halogen functional groups. It is primarily used as a reagent in organic synthesis and research, with reference numbers provided for the compound without isomeric designation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 20679-58-7
4-(2-bromoacetyl)oxybut-2-enyl 2-bromoacetate
SIHKVAXULDBIIY-UHFFFAOYSA-N
C(C=CCOC(=O)CBr)OC(=O)CBr