p-Carborane is a boron cluster compound characterized by a cage-like molecular structure. It serves as a precursor in the synthesis of other boron-rich compounds for research and industrial applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 20644-12-6
1,7-Dicarbadodecaborane(12)
boron cluster chemistry building block
4-Butylbenzoic acid
Building block for organic synthesis
2,5-Dicyanopyridine
chemical intermediate for synthesis
2-Bromo-2-methylpropionyl bromide
Fine and large scale chemical synthesis
Nickel bis(trifluoromethylsulfonyl)imide
Electrolyte material for batteries
CFNUZRMHHJZBOM-UHFFFAOYSA-N
[B]1[B][B][B]C2[B][B]C([B]2)[B][B][B]1