Chlorotri(methyl-d3)silane is a deuterated chlorosilane compound used as a research reagent. Its primary significance lies in serving as a stable isotope-labeled building block for synthetic chemistry and materials science studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Chlorotri(methyl-d3)silane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
D-Arginine, N2-((1,1-dimethylethoxy)carbonyl)-, monohydrochloride, monohydrate
Research reagent for peptide synthesis
THIOPHENE-2,5-D2
deuterated research compound
(R)-1-(3-(3-Amino-6-(2-fluoro-5-isopropoxyphenyl)pyrazine-2-carboxamido)pyridin-4-yl)piperidine-3-carboxylic acid
research compound
Chlorotrimethylsilane
Silylating agent and silicone intermediate
Chlorotri(methyl-d3)silane(CAS 20395-57-7)의 국제 HS 코드는 2845.90입니다.
2845.90
2845 90 10
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
chloro-tris(trideuteriomethyl)silane
IJOOHPMOJXWVHK-GQALSZNTSA-N
[2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl
Chlorotri(methyl-d3)silane 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.