Chlorotri(methyl-d3)silane is a deuterated chlorosilane compound used as a research reagent. Its primary significance lies in serving as a stable isotope-labeled building block for synthetic chemistry and materials science studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 20395-57-7
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
D-Arginine, N2-((1,1-dimethylethoxy)carbonyl)-, monohydrochloride, monohydrate
Research reagent for peptide synthesis
THIOPHENE-2,5-D2
deuterated research compound
(R)-1-(3-(3-Amino-6-(2-fluoro-5-isopropoxyphenyl)pyrazine-2-carboxamido)pyridin-4-yl)piperidine-3-carboxylic acid
research compound
Chlorotrimethylsilane
Silylating agent and silicone intermediate
chloro-tris(trideuteriomethyl)silane
IJOOHPMOJXWVHK-GQALSZNTSA-N
[2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])Cl