This compound is an Fmoc-protected amino acid derivative used as a pharmaceutical intermediate. It features a pyrrolidine ring with two fluorine atoms and a tert-butoxycarbonyl (Boc) protecting group, making it suitable for peptide synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-boc-4,4-difluoro-d-prolinamide
chemical research reagent
(R)-1-N-Boc-3-Methylaminopiperidine
Pharmaceutical intermediate for chiral amine synthesis
Isobutyrophenone
pharmaceutical intermediate
5-((5-Chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)methyl)pyridin-2-amine
Pharmaceutical intermediate synthesis
3-Bromo-9H-fluoren-9-one
pharmaceutical intermediate
(2S)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
WTMZYKCXBXPVPT-LURJTMIESA-N
CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)O)(F)F
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.