L-(-)-3-Phenyllactic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of drug substances. It features a chiral center, a carboxylic acid group, a secondary alcohol, and an aromatic ring, contributing to its utility in organic synthesis and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
L-(-)-3-Phenyllactic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
L-4-Hydroxyphenylglycine
pharmaceutical intermediate for drug synthesis
(R)-Indoline-2-carboxylic Acid
pharmaceutical intermediate for drug synthesis
(S)-4,4-Difluoropyrrolidine-2-carboxylic acid hydrochloride
pharmaceutical intermediate for drug synthesis
3-Bromofuran
pharmaceutical intermediate for drug synthesis
Bromoacetaldehyde diethyl acetal
pharmaceutical intermediate
Diethyl (phenylacetyl)propanedioate
pharmaceutical intermediate for synthesis
2,2-Dimethyl-1,3-dioxane-4,6-dione
organic synthesis intermediate
5,6-Dichloro-1,3-dihydro-2H-benzimidazol-2-one
pharmaceutical intermediate
L-(-)-3-Phenyllactic acid(CAS 20312-36-1)의 국제 HS 코드는 2918.19입니다.
2918.19
2918 19 98
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-2-hydroxy-3-phenylpropanoic acid
VOXXWSYKYCBWHO-QMMMGPOBSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)O
L-(-)-3-Phenyllactic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.