Gly-Gly-Phe-Gly is a synthetic tetrapeptide consisting of glycine, glycine, phenylalanine, and glycine residues. It is primarily used as a research peptide standard in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 200427-88-9
(S)-16-Amino-10-benzyl-6,9,12,15-tetraoxo-3-oxa-5,8,11,14-tetraazahexadecan-1-oic acid
research compound
H-Ala-Ala-Ala-Ala-Ala-OH
research peptide standard
Methyl (2R)-2-bromopropanoate
research compound
Oxytocin antiparallel dimer
research compound
P-(2-(Dimethylamino)ethoxy)benzylamine
research compound
((Z)-2-((3R,4R,5R)-3,5-bis((tert-butyldimethylsilyl)oxy)-4-(3-((tert-butyldimethylsilyl)oxy)propoxy)-2-methylenecyclohexylidene)ethyl)diphenylphosphine oxide
research compound
2-[[(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-phenylpropanoyl]amino]acetic acid
HXUVTXPOZRFMOY-NSHDSACASA-N
C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)CNC(=O)CN