Benz(e)aceanthrylene is a polycyclic aromatic hydrocarbon that has been evaluated by the International Agency for Research on Cancer (IARC) and classified in Group 3, meaning it is not classifiable as to its carcinogenicity to humans due to inadequate evidence in humans and inadequate or limited evidence in experimental animals. This compound is primarily encountered in research contexts, particularly in studies related to chemical carcinogenesis and environmental toxicology.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Benz(e)aceanthrylene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
pentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(19),2,4,6,8,10,12(20),13,15,17-decaene
YPMKRLARTMANBR-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C3C=CC4=C3C2=CC5=CC=CC=C45
Benz(e)aceanthrylene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.