Benz(e)aceanthrylene is a polycyclic aromatic hydrocarbon that has been evaluated by the International Agency for Research on Cancer (IARC) and classified in Group 3, meaning it is not classifiable as to its carcinogenicity to humans due to inadequate evidence in humans and inadequate or limited evidence in experimental animals. This compound is primarily encountered in research contexts, particularly in studies related to chemical carcinogenesis and environmental toxicology.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 199-54-2
pentacyclo[10.7.1.02,7.09,20.013,18]icosa-1(19),2,4,6,8,10,12(20),13,15,17-decaene
YPMKRLARTMANBR-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C3C=CC4=C3C2=CC5=CC=CC=C45