Neopentyl glycol dimethacrylate is a chemical compound used primarily as a monomer for polymer synthesis. It features two ester groups and is characterized by a molecular weight of 240.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Neopentyl glycol dimethacrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Diethyl itaconate
monomer for polymer synthesis
HEXADECYL METHACRYLATE
monomer for polymer synthesis
BENZYL METHACRYLATE
monomer for polymer synthesis
2-Propenoic acid, 2-methyl-, 1-ethylcyclopentyl ester (9CI, ACI)
monomer for polymer synthesis
1,4-Benzenedicarboxylic acid, bis(phenylmethyl) ester
plasticizer intermediate for polymers
4-HEPTYLPHENOL
Alkylphenol intermediate for industrial synthesis
2,6-Diisopropyl-1,4-benzoquinone
benzoquinone derivative for chemical synthesis
N,N,N-trimethylcyclohexanaminium hydroxide
phase transfer catalyst
Neopentyl glycol dimethacrylate(CAS 1985-51-9)의 국제 HS 코드는 2916.14입니다.
2916.14
2916 14 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
[2,2-dimethyl-3-(2-methylprop-2-enoyloxy)propyl] 2-methylprop-2-enoate
ULQMPOIOSDXIGC-UHFFFAOYSA-N
CC(=C)C(=O)OCC(C)(C)COC(=O)C(=C)C
Neopentyl glycol dimethacrylate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.