PQ 401 is a research compound that acts as an antagonist of the insulin-like growth factor 1 receptor (IGF-1R). It is a member of the quinoline chemical class and is used primarily in laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
PQ 401 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(R)-(+)-2-Methyl-2-propanesulfinamide
chiral auxiliary for asymmetric synthesis
2-methylpyrimidine-4,6-diamine
research compound
2,4-Dichlorophenylacetic acid
research compound
Diethyl azodicarboxylate
Reagent in synthetic organic chemistry
1-(5-chloro-2-methoxyphenyl)-3-(2-methylquinolin-4-yl)urea
YBLWOZUPHDKFOT-UHFFFAOYSA-N
CC1=NC2=CC=CC=C2C(=C1)NC(=O)NC3=C(C=CC(=C3)Cl)OC
PQ 401 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.