Methyl 2,6-difluoro-4-hydroxybenzoate is a fluorinated aromatic ester used primarily as a research compound in chemical synthesis. Its structure features a difluorinated benzene ring with both ester and hydroxyl functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 194938-88-0
4-Iodo-2-(trifluoromethyl)benzonitrile
research compound for chemical synthesis
(6-bromo-2-pyridyl)-pentafluoro-sulfane
research compound for chemical synthesis
1-Aminohydantoin hydrochloride
research compound for chemical synthesis
2-chloro-4,6-diphenylpyrimidine
research compound for chemical synthesis
4-Methoxyphenylhydrazine hydrochloride
Chemical research reagent
Methyl 4-(7-(6-cyano-5-(trifluoromethyl)pyridin-3-yl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]octan-5-yl)-2-fluorobenzoate
research compound
2-Tolylboronic acid pinacol ester
Boronic acid ester for Suzuki coupling
4-Chlorochrysene
Research compound for chemical studies
methyl 2,6-difluoro-4-hydroxybenzoate
ZPVGRBTXDTZVIG-UHFFFAOYSA-N
COC(=O)C1=C(C=C(C=C1F)O)F
—