4-Bromo-2,3-difluorobenzoic acid is a halogenated aromatic carboxylic acid used as a pharmaceutical intermediate in chemical synthesis. Its structure features a bromine atom and two fluorine substituents on the benzene ring, along with a carboxylic acid group, contributing to its utility in building more complex organic molecules for drug development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 194804-91-6
4-Fluoro-2-(trifluoromethyl)benzonitrile
pharmaceutical intermediate
Methoxyacetic anhydride
Pharmaceutical intermediate for decitabine
1H-1,2,4-Triazole-1-carboximidamide hydrochloride
Pharmaceutical intermediate for antiviral synthesis
1-amino-N-[6-cyano-5-(trifluoromethyl)-3-pyridyl]cyclobutanecarboxamide
Pharmaceutical intermediate
4-bromo-2,3-difluorobenzoic acid
IRUDFVTZXQTEFN-UHFFFAOYSA-N
C1=CC(=C(C(=C1C(=O)O)F)F)Br