This compound is a tetrazolium salt used as a reagent in cell proliferation assays. It is a sodium salt characterized by its water solubility and the presence of nitro and sulfonate groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1,2-Dipiperidinoethane
research compound
(3s,4r)-3-fluorooxan-4-ol
Research intermediate for fluorinated heterocycles
(3S,4R)-3-fluoro-1-methylpiperidin-4-ol
research compound
Di(4-t-butylphenyl)iodonium camphorsulfonate
photoacid generator reagent
2,3,5-Triphenyltetrazolium chloride
Redox indicator for cellular respiration
Iodonitrotetrazolium chloride
Histological dye
sodium 4-[2-(2-methoxy-4-nitrophenyl)-3-(4-nitrophenyl)tetrazol-2-ium-5-yl]benzene-1,3-disulfonate
VSIVTUIKYVGDCX-UHFFFAOYSA-M
COC1=C(C=CC(=C1)[N+](=O)[O-])[N+]2=NC(=NN2C3=CC=C(C=C3)[N+](=O)[O-])C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+]
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.