4-Chloroaniline-2,3,5,6-d4 is a deuterated analytical reference standard used primarily in quantitative mass spectrometry and internal standard methods. Its isotopic labeling allows for accurate quantification of 4-chloroaniline in complex matrices.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 191656-33-4
Lawesson's reagent
Thionating agent for carbonyls
2-Thiopheneacetic acid
research compound
2-methylthiophene-3-carboxylic acid
research compound
Aristeromycin
nucleoside analogue research compound
4-CHLOROANILINE
Chemical intermediate for dyes
4-chloro-2,3,5,6-tetradeuterioaniline
QSNSCYSYFYORTR-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1N)[2H])[2H])Cl)[2H]