(2-(Benzyloxy)phenyl)boronic acid is a boronic acid derivative containing a benzyl ether group. It is primarily used as a synthetic building block in cross-coupling reactions for laboratory and research applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(2-(Benzyloxy)phenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Potassium Trifluoro(2-fluoro-6-hydroxyphenyl)borate
synthetic building block for cross-coupling
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
Lithium 2-methylpropan-2-olate
strong base reagent
Piperidinium, 1,1-diethyl-2,6-dimethyl-, bromide
structure directing agent
4,4,5,5-tetramethyl-2-(2-nitrophenyl)-1,3,2-dioxaborolane
research compound
2-BROMOTRIPHENYLENE
research compound
(2-phenylmethoxyphenyl)boronic acid
MCAIDINWZOCYQK-UHFFFAOYSA-N
B(C1=CC=CC=C1OCC2=CC=CC=C2)(O)O
(2-(Benzyloxy)phenyl)boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.