This compound is a protected phosphoramidate intermediate used in the chemical synthesis of certain nucleoside analogs. Its complex structure incorporates multiple chiral centers and functional groups that are characteristic of advanced pharmaceutical intermediates.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1884576-18-4
렘데시비르
active pharmaceutical ingredient
5-Amino-N1-methyl-1H-imidazole-1,4-dicarboxamide
Pharmaceutical intermediate
Tert-butyl (3R,4R)-3-amino-4-(hydroxymethyl)pyrrolidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
Ethanamine, 1,1-dimethoxy-N,N-dimethyl-
pharmaceutical intermediate
N'-((2S,3S)-2-(Benzyloxy)pentan-3-yl)formohydrazide oxalate
pharmaceutical intermediate
2-ethylbutyl (2S)-2-[[[(3aR,4R,6R,6aR)-4-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methoxy-phenoxyphosphoryl]amino]propanoate
MDIHKUBDAVKDMZ-JURYWZNGSA-N
CCC(CC)COC(=O)[C@H](C)N[P@](=O)(OC[C@@H]1[C@@H]2[C@H]([C@](O1)(C#N)C3=CC=C4N3N=CN=C4N)OC(O2)(C)C)OC5=CC=CC=C5