This compound is an organosulfur derivative featuring a thiophene ring substituted with chloro, carboxylic acid, and sulfonic acid groups. It is primarily encountered as a research reagent or building block in chemical synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 187746-94-7
5-chloro-3-sulfothiophene-2-carboxylic acid
RBQFMYATYGPWNV-UHFFFAOYSA-N
C1=C(SC(=C1S(=O)(=O)O)C(=O)O)Cl