Dacisteine is an N-acyl-L-amino acid and a small molecule compound used as an active pharmaceutical ingredient. It features amide and carboxylic acid functional groups, with a molecular weight of approximately 205 Da.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 18725-37-6
Elimusertib
active pharmaceutical ingredient
2(1H)-pyrimidinone, tetrahydro-4-hydroxy-1-beta-D-ribofuranosyl-
nucleotide metabolism inhibitor
Derquantel
anthelmintic active pharmaceutical ingredient
Abacavir sulfate
active pharmaceutical ingredient
(2R)-2-acetamido-3-acetylsulfanylpropanoic acid
HSPYGHDTVQJUDE-LURJTMIESA-N
CC(=O)N[C@@H](CSC(=O)C)C(=O)O