2-Methyl-3-nitropyridine is a chemical compound used primarily as a pharmaceutical intermediate. It features a pyridine ring substituted with a methyl group and a nitro group, contributing to its role in the synthesis of various pharmaceutical compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Methyl-3-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-4-(3-bromophenyl)-6,8-dichloro-2-methyl-1,2,3,4-tetrahydroisoquinoline
pharmaceutical intermediate
Mc-Val-Ala-PAB
pharmaceutical intermediate
2,3-Difluoro-6-methoxybenzaldehyde
Pharmaceutical intermediate
(2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-{N'-[(2,2,4,6,7-pentamethyl-2,3-dihydro-1-benzofuran-5-yl)sulfonyl]carbamimidamido}pentanoic acid
Protected arginine building block for peptide synthesis
2-methyl-3-nitropyridine
CCFGTKQIRWHYTB-UHFFFAOYSA-N
CC1=C(C=CC=N1)[N+](=O)[O-]
2-Methyl-3-nitropyridine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.