Isoleucine methyl ester hydrochloride is a chemical compound used as a research reagent, typically in laboratory settings for synthetic and biochemical studies. It is the hydrochloride salt form of the methyl ester derivative of the amino acid isoleucine.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 18598-74-8
3-chlorophenylzinc iodide
organometallic reagent for cross-coupling
Fmoc-Ala-Pro-OH
research compound for peptide synthesis
Fmoc-Val-Ser(Psime,Mepro)-OH
building block for peptide synthesis
Fmoc-PNA-C(Bhoc)-OH
Peptide nucleic acid building block
methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride
GGTBEWGOPAFTTH-GEMLJDPKSA-N
CC[C@H](C)[C@@H](C(=O)OC)N.Cl