1,2-O-Isopropylidene-alpha-D-glucofuranose is a protected sugar derivative commonly employed as a pharmaceutical intermediate in organic synthesis. Its structure features a fused ring system with multiple alcohol and ether groups, making it a versatile building block for preparing more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 18549-40-1
(3R,3aR,6S,6aR)-Hexahydrofuro[3,2-b]furan-3,6-diyl bis(4-hydroxybenzoate)
Pharmaceutical intermediate
Dihydro-4-(2-methylpropyl)-2H-Pyran-2,6(3H)-dione
Pharmaceutical intermediate
2-(((3aR,4S,6R,6aS)-6-(7-Amino-5-(propylthio)-3H-[1,2,3]triazolo[4,5-d]pyrimidin-3-yl)-2,2-dimethyltetrahydro-4H-cyclopenta[d][1,3]dioxol-4-yl)oxy)ethan-1-ol
Pharmaceutical impurity reference standard
3-Amino-2-methylbenzoic Acid Methyl Ester
pharmaceutical intermediate
((3aR,5S,6aR)-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanol
research compound
(1R)-1-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol
BGGCXQKYCBBHAH-OZRXBMAMSA-N
CC1(O[C@@H]2[C@H]([C@H](O[C@@H]2O1)[C@@H](CO)O)O)C