This compound is a research reagent featuring a Boc-protected piperidine core with a fluorenylmethyloxycarbonyl-based substituent and a carboxylic acid group. It is structurally designed to serve as a building block in multistep organic synthesis, where protecting groups are employed to achieve chemoselectivity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
1-(9H-fluoren-9-ylmethoxycarbonyl)-4-(tert-butoxycarbonylamino)piperidine-4-carboxylate
protected amino acid building block
2-Methyl-6-nitropyridine
research compound
4-Methyl-2-nitropyridine
research compound
3-(Trifluoromethyl)phenyl isothiocyanate
research compound
5'-Adenylic acid, monohydrate
Purine ribonucleoside monophosphate research reagent
4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid
BOFOACPQHWDRLH-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.