This compound is a boron-containing heterocyclic molecule used as a pharmaceutical intermediate in research and manufacturing. Its structure incorporates an imidazo[1,2-b]pyridazine core with a dioxaborolane substituent, making it suitable for use in synthetic chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1825352-86-0
(S)-GNA-G(iBu) phosphoramidite
Pharmaceutical intermediate for oligonucleotide synthesis
4-chloro-3-iodopyridine-2-carbonitrile
pharmaceutical intermediate
4-Iodobenzyl alcohol
pharmaceutical intermediate
Dimethyl 3-oxopentanedioate
Pharmaceutical intermediate
2,8-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-b]pyridazine
UCBLAGDTLLXGNA-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=NN3C=C(N=C3C(=C2)C)C
—