Methyl 5-bromo-2-iodobenzoate is a chemical compound used primarily as a pharmaceutical intermediate. Its structure features an aromatic ring substituted with bromine and iodine atoms, along with an ester group, making it useful in organic synthesis for preparing more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Methyl 5-bromo-2-iodobenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Pre-doxercalciferol
vitamin D analog intermediate
N-(2-Hydroxyethyl)succinimide
pharmaceutical intermediate
Fmoc-4-(tert-butoxycarbonylmethoxy)-L-phenylalanine
Fmoc-protected amino acid building block
T-Butyl (4R)-4-amino-3,3-difluoropiperidine-1-carboxylate
pharmaceutical intermediate
methyl 5-bromo-2-iodobenzoate
CJRHLSZJEFJDLA-UHFFFAOYSA-N
COC(=O)C1=C(C=CC(=C1)Br)I
Methyl 5-bromo-2-iodobenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.