4-Fluoro-D-phenylalanine is a fluorinated derivative of D-phenylalanine used as an intermediate in pharmaceutical manufacturing. Its structure features an aromatic ring with a fluorine substituent, contributing to its role in the synthesis of peptide-based compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 18125-46-7
3-bromo-4-chloropyridine hydrochloride
Pharmaceutical intermediate
Tert-Butyl 3-methyl-4-oxopiperidine-1-carboxylate
Pharmaceutical intermediate
3-(Carbamoylmethyl)-5-methylhexanoic acid
pharmaceutical intermediate
(3R)-3-(2-amino-2-oxoethyl)-5-methylhexanoic acid
pharmaceutical intermediate
4-FLUORO-L-PHENYLALANINE
Research reagent for amino acid studies
(2R)-2-amino-3-(4-fluorophenyl)propanoic acid
XWHHYOYVRVGJJY-MRVPVSSYSA-N
C1=CC(=CC=C1C[C@H](C(=O)O)N)F