(-)-Erinacin A is a chiral indene glycoside compound used as a certified reference standard for analytical testing. Its primary significance lies in ensuring accurate quantification and identification in laboratory research and quality control.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 180854-04-0
(3aS,5aS,6R)-3a,5a-dimethyl-1-propan-2-yl-6-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxy-2,3,4,5,6,7-hexahydrocyclohepta[e]indene-8-carbaldehyde
LPPCHLAEVDUIIW-QUDDMMEISA-N
CC(C)C1=C2C3=CC=C(C[C@H]([C@]3(CC[C@@]2(CC1)C)C)O[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)C=O