2,6-Difluorobenzamide is an agrochemical compound used primarily as an intermediate in the synthesis of benzoylurea insecticides, such as bistrifluron. It contains an amide functional group and two fluorine atoms on an aromatic ring, contributing to its role in insecticide manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2,6-Difluorobenzamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phenylphosphonic acid
insecticide intermediate
Sodium feredetate
chelating agent for soil fertilization
Ethiprole
Agriculture Crop Protection
2-NP-AMOZ
Nitrofuran metabolite marker for food safety
Tetrafluorophthalonitrile
soil pesticides and chemical intermediates
2,6-Difluorobenzamide(CAS 18063-03-1)의 국제 HS 코드는 2924.29입니다.
2924.29
2924 29 70
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
2,6-difluorobenzamide
AVRQBXVUUXHRMY-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)C(=O)N)F
2,6-Difluorobenzamide 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.