This compound is a boronic ester derivative of benzoic acid, commonly used as a pharmaceutical intermediate. Its structure features a dioxaborolane ring attached to a benzoic acid moiety, making it suitable for carbon-carbon bond formation in drug synthesis.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 180516-87-4
N-alpha-(9-Fluorenylmethyloxycarbonyl)-N-beta-trityl-D-asparagine
Peptide synthesis building block
1,1-Cyclopentanedicarboxylic acid, 3-oxo-, diethyl ester
pharmaceutical intermediate
METHYL N-CBZ-PIPERIDINE-2-CARBOXYLATE
Peptide synthesis protecting group intermediate
2,6-Difluorobenzoyl chloride
Pharmaceutical intermediate for synthesis
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid
IYDKBQIEOBXLTP-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O
—