This compound is a protected proline derivative featuring an unsaturated pyrrole ring and tert-butyloxycarbonyl (Boc) and ethyl ester functional groups. It is primarily used as a pharmaceutical intermediate in the synthesis of complex organic molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 178172-26-4
1-N-Boc-4-fluoropiperidine
pharmaceutical intermediate
Methyl 2-hydroxy-3-methoxy-3,3-diphenylpropanoate
pharmaceutical intermediate compound
(R)-2-Hydroxy-3-methoxy-3,3-diphenylpropanoic acid
Pharmaceutical intermediate for ambrisentan
2-hydroxy-3-methoxy-3,3-diphenylpropanoic acid
Pharmaceutical intermediate for impurities
1-O-tert-butyl 2-O-ethyl (2S)-2,3-dihydropyrrole-1,2-dicarboxylate
AZVLZXHTXUIWRZ-VIFPVBQESA-N
CCOC(=O)[C@@H]1CC=CN1C(=O)OC(C)(C)C