This compound is an organic compound featuring two aromatic rings and a hydroxyl group. Its classification regarding carcinogenicity to humans has not been established by the International Agency for Research on Cancer (IARC), based on inadequate evidence in humans and inadequate or limited evidence in experimental animals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17755-10-1
2-methyl-6-phenylphenol
PGJXFACHLLIKFG-UHFFFAOYSA-N
CC1=C(C(=CC=C1)C2=CC=CC=C2)O