This compound is an organic compound featuring two aromatic rings and a hydroxyl group. Its classification regarding carcinogenicity to humans has not been established by the International Agency for Research on Cancer (IARC), based on inadequate evidence in humans and inadequate or limited evidence in experimental animals.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-Methyl-[1,1'-biphenyl]-2-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-methyl-6-phenylphenol
PGJXFACHLLIKFG-UHFFFAOYSA-N
CC1=C(C(=CC=C1)C2=CC=CC=C2)O
3-Methyl-[1,1'-biphenyl]-2-ol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.