Ethyl-d5-amine is a deuterated amine compound where all five hydrogen atoms on the ethyl group are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry, particularly in mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17616-24-9
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
Methyl(2H3)ammonium chloride
Deuterated amine reference standard
Diethyl [2,2'-bipyridine]-4,4'-dicarboxylate
bipyridine ligand for coordination chemistry
4-Bromo-p-terphenyl
Research chemical for organic synthesis
5-Chlorooxindole
Research compound for pharmaceutical intermediates
1,4-Dioxane-d8
deuterated NMR reference standard
Ethylamine hydrochloride
production of resins and rubber latex
Ethanamine
Intermediate for herbicides and organic synthesis
1,1,2,2,2-pentadeuterioethanamine
QUSNBJAOOMFDIB-ZBJDZAJPSA-N
[2H]C([2H])([2H])C([2H])([2H])N