This compound is a deuterated form of 2-chlorobutane used primarily as a research reagent. Its structure incorporates nine deuterium atoms, providing a stable isotopic label for analytical and laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 175540-77-9
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol
Research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
Tris[[2-(tert-butoxycarbonyl)ethoxy]methyl]methylamine
Research reagent for chemical synthesis
(2R,3R)-1-(Dimethylamino)-3-(3-methoxyphenyl)-2-methylpentan-3-ol--hydrogen chloride (1/1)
Research compound
2-CHLOROBUTANE
Organic synthesis intermediate
2-chloro-1,1,1,2,3,3,4,4,4-nonadeuteriobutane
BSPCSKHALVHRSR-CBZKUFJVSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])Cl