This compound is a Fmoc-protected phospho-amino acid derivative of L-threonine, featuring a benzylphospho protective group on the hydroxyl side chain. It is primarily used as an intermediate in the solid-phase synthesis of phosphopeptides for research and pharmaceutical development.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 175291-56-2
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(pyridin-3-yl)propanoic acid
Pharmaceutical intermediate for peptide synthesis
(s)-n-fmoc-4-chlorophenylalanine
Pharmaceutical intermediate for peptide synthesis
Tert-Butyl 3-cyano-4-oxo-pyrrolidine-1-carboxylate
pharmaceutical intermediate
1,3-Cyclohexanedione, 2-acetyl-5,5-dimethyl-
pharmaceutical intermediate for synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxypropanoic acid
phosphorylated serine building block
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[hydroxy(phenylmethoxy)phosphoryl]oxybutanoic acid
HOFDVXHILSPFNS-OSPHWJPCSA-N
C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OP(=O)(O)OCC4=CC=CC=C4