1H,1H,2H,2H-perfluorooctyl acrylate is a fluorotelomer acrylate monomer used as an industrial chemical. It is characterized by an ester functional group and a high degree of fluorination, contributing to its hydrophobic and oleophobic properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17527-29-6
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl prop-2-enoate
VPKQPPJQTZJZDB-UHFFFAOYSA-N
C=CC(=O)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F