O-Benzylglycine toluene-p-sulphonate is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients (APIs). It is supplied as a salt-like form containing an aromatic ring and an ester group.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1738-76-7
Benzyl glycinate
amino acid ester reagent
4-Methylbenzene-1-sulfonic acid--benzyl beta-alaninate (1/1)
peptide coupling reagent intermediate
Tert-butyl N-(azetidin-3-yl)carbamate hydrochloride
pharmaceutical intermediate for API synthesis
Piperazine, 1-[[2-(4-chlorophenyl)-4,4-dimethyl-1-cyclohexen-1-yl]methyl]-
pharmaceutical intermediate for API synthesis
4-(Benzyloxycarbonyl)phenylboronic acid
pharmaceutical intermediate for API synthesis
Benzyl (3S,4R)-3-ethyl-4-(3H-imidazo(1,2-a)pyrrolo-(2,3-e)pyrazin-8-yl)pyrrolidine-1-carboxylate
pharmaceutical intermediate for API synthesis
O-Benzyl-L-leucine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
H-Phe-OBzl.TosOH
protected phenylalanine derivative for peptide synthesis
benzyl 2-aminoacetate;4-methylbenzenesulfonic acid
WJKJXKRHMUXQSL-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)O.C1=CC=C(C=C1)COC(=O)CN