This compound is a deuterated form of thiourea, where all four hydrogen atoms on the amino groups are replaced with deuterium. It is primarily used as a labeled research compound in laboratory settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 17370-85-3
Benzene, (2-iodoethyl)-
research reagent
Benzyl glycinate
amino acid ester reagent
1,2-Dimethylimidazole
Research reagent and catalyst
Methyl (R)-lactate
enantiomerically pure methyl lactate
Thiocarbamide
Intermediate in chemical manufacturing
1,1,3,3-tetradeuteriothiourea
UMGDCJDMYOKAJW-JBISRTOLSA-N
[2H]N([2H])C(=S)N([2H])[2H]