This compound is a research compound featuring a pyrazole ring substituted with a benzyl group and a difluoromethoxy moiety. It is primarily used as a laboratory reagent for chemical and biological studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1710661-08-7
Ethane-1,1,2-d3, 1,2,2-trichloro-
deuterated reference standard
3-Methylbenzoyl chloride
chemical synthesis intermediate
Cerium(4+);bis(tetraethylazanium);hexachloride
research reagent
4-Ethoxy-1,1,1-trifluoro-3-buten-2-one
research compound
Ethyl 5-amino-1-(2-fluorobenzyl)-1H-pyrazole-3-carboxylate
pharmaceutical intermediate
1-benzyl-5-(difluoromethoxy)pyrazole-3-carboxylic acid
MGLYBLIDYKGLFA-UHFFFAOYSA-N
C1=CC=C(C=C1)CN2C(=CC(=N2)C(=O)O)OC(F)F
—