Ammonium titanium fluoride is an industrial chemical commonly used as a fluorinating agent or precursor. It occurs as a salt composed of ammonium and hexafluorotitanate ions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16962-40-6
Decaammonium tungstate
Tungsten alloy production
아이오딘화 암모늄
Photographic chemicals and expectorant
염화 암모늄
Fertilizer and soldering flux
황화 암모늄
Applying patina to bronze
2,2'-Dinitrodibenzyl
chemical intermediate for organic synthesis
1,7-Dicarbadodecaborane(12)
boron cluster chemistry building block
Methanol
solvent, antifreeze, chemical intermediate
Tribromomethyl phenyl sulfone
Industrial brominated sulfone reagent
diazanium;hexafluorotitanium(2-)
NMGYKLMMQCTUGI-UHFFFAOYSA-J
[NH4+].[NH4+].F[Ti-2](F)(F)(F)(F)F