1-Adamantyl methacrylate is a monomer used in polymer synthesis. Its structure combines a rigid, strain-free adamantane cage with a methacrylate ester group, making it valuable for producing specialty polymers with enhanced thermal and mechanical properties.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16887-36-8
3-[(2-METHYLPROP-2-ENOYL)OXY]ADAMANTAN-1-YL 2-METHYLPROP-2-ENOATE
polymer crosslinking monomer
3-Hydroxy-1-adamantyl methacrylate
Monomer for polymer synthesis
Gamma-butyrolactone methacrylate
Monomer for polymer synthesis
Phenyl methacrylate
Monomer for polymer synthesis
Methyl 2-fluoroacrylate
Monomer for polymer synthesis
Sodium hexafluorosilicate
wood preservative, glass manufacturing, pesticides
Perfluorobutyl 1,3-dioxo-1H-benzo[de]isoquinoline-2(3H)-sulfonate
sulfonate ester reagent
Ammonium hexafluorosilicate
insecticide, miticide, wood preservative
1-adamantyl 2-methylprop-2-enoate
MZVABYGYVXBZDP-UHFFFAOYSA-N
CC(=C)C(=O)OC12CC3CC(C1)CC(C3)C2