Fosbretabulin disodium is the disodium salt of a water-soluble phosphate derivative of a natural stilbenoid phenol derived from the African bush willow (Combretum caffrum). It functions as a prodrug that is dephosphorylated to the active metabolite combretastatin A4, a microtubule-depolymerizing agent that disrupts tumor vasculature, leading to reduced blood flow and ischemic necrosis in tumor tissue.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 168555-66-6
Conivaptan hydrochloride
Vasopressin receptor antagonist
(R)-5-(AZIDOMETHYL)-3-[3-FLUORO-4-(4-MORPHOLINYL)PHENYL]-2-OXAZOLIDINONE
antibiotic impurity reference standard
(5S)-5-(Aminomethyl)-3-[3-fluoro-4-(4-morpholinyl)phenyl]-2-oxazolidinone
active pharmaceutical ingredient impurity
TAS-115 mesylate
active pharmaceutical ingredient
disodium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate
VXNQMUVMEIGUJW-XNOMRPDFSA-L
COC1=C(C=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+]