This compound is a research reagent, specifically the tritosylate derivative of diethanolamine. Its crystal structure has been characterized in published crystallographic studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16695-22-0
4-chloro-3-methyl-1,2-oxazol-5-amine
research compound
Benzamidine hydrochloride
research reagent for amidine chemistry
Indole-5-carboxylic acid
biochemical research reagent
Alpha-Methyl-L-tryptophan
research compound for tryptophan metabolism studies
2-[(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonyloxyethyl]amino]ethyl 4-methylbenzenesulfonate
VJDZYMIEDBLSDT-UHFFFAOYSA-N
CC1=CC=C(C=C1)S(=O)(=O)N(CCOS(=O)(=O)C2=CC=C(C=C2)C)CCOS(=O)(=O)C3=CC=C(C=C3)C