4-(Trifluoromethyl)cinnamic acid is a chemical compound commonly used as a research reagent in physicochemical studies. It is particularly relevant in organic chemistry for investigating substituent effects on reaction rates and equilibria, as described by the Hammett equation.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16642-92-5
Di-MU-iodobis(tri-t-butylphosphino)dipalladium(I)
research reagent for catalysis
(2H3)Acetic anhydride
deuterated NMR reference standard
Methylene chloride-D2
NMR solvent
5-FLUORO-4-HYDRAZINO-2-METHOXYPYRIMIDINE
research compound
(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoic acid
ANRMAUMHJREENI-ZZXKWVIFSA-N
C1=CC(=CC=C1/C=C/C(=O)O)C(F)(F)F