Tetraethyl methylenediphosphonate is a chemical compound used as a pharmaceutical intermediate. It features a diphosphonate structure with four ethyl groups and is employed in the synthesis of various organic compounds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Tetraethyl methylenediphosphonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(4R)-4-methyl-1,3-dioxolan-2-one
Chiral intermediate for tenofovir disoproxil fumarate
2-{2-[2-({[(9H-FLUOREN-9-YL)METHOXY]CARBONYL}AMINO)ETHOXY]ETHOXY}ACETIC ACID
Fmoc-protected PEG linker for peptide synthesis
5-Amino-4-cyanopyrazole
pharmaceutical intermediate
(23S,50S)-50-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-23-(tert-butoxycarbonyl)-2,2-dimethyl-4,21,26,35,44-pentaoxo-3,30,33,39,42-pentaoxa-22,27,36,45-tetraazahenpentacontan-51-oic acid
peptide synthesis intermediate
1-[diethoxyphosphorylmethyl(ethoxy)phosphoryl]oxyethane
STJWVOQLJPNAQL-UHFFFAOYSA-N
CCOP(=O)(CP(=O)(OCC)OCC)OCC
Tetraethyl methylenediphosphonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.