4-Methyl-3,5-dinitrobenzoic acid is a chemical compound used primarily as an intermediate in organic synthesis. It features a benzoic acid core substituted with methyl and nitro groups, contributing to its reactivity in further chemical transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 16533-71-4
Disodium 1,5-naphthalenedisulfonate
anti-scaling and corrosion inhibitor
Disodium 2,7-naphthalenedisulfonate
naphthalene sulfonate intermediate for dyes
SODIUM OLEATE
Emulsifier and ore flotation agent
2-Methoxyethyl vinyl ether
Industrial polymer production
4-methyl-3,5-dinitrobenzoic acid
LZWWZQXBKVZKIP-UHFFFAOYSA-N
CC1=C(C=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-]