4-Methyl-3,5-dinitrobenzoic acid is a chemical compound used primarily as an intermediate in organic synthesis. It features a benzoic acid core substituted with methyl and nitro groups, contributing to its reactivity in further chemical transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Methyl-3,5-dinitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Disodium 1,5-naphthalenedisulfonate
anti-scaling and corrosion inhibitor
Disodium 2,7-naphthalenedisulfonate
naphthalene sulfonate intermediate for dyes
SODIUM OLEATE
Emulsifier and ore flotation agent
2-Methoxyethyl vinyl ether
Industrial polymer production
4-Methyl-3,5-dinitrobenzoic acid(CAS 16533-71-4)의 국제 HS 코드는 2916.39입니다.
2916.39
2916 39 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
4-methyl-3,5-dinitrobenzoic acid
LZWWZQXBKVZKIP-UHFFFAOYSA-N
CC1=C(C=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-]
4-Methyl-3,5-dinitrobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.