This compound is a phosphorus-containing organic molecule used as an impurity reference standard for alendronic acid, a bisphosphonate compound. It is primarily employed in pharmaceutical research and quality control to identify and quantify related substances.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 165043-20-9
6-CHLORO-2-FLUOROPURINE
research compound
(8R,9S,10R,13S,14S,17R)-2,2,4,6,6-Pentadeuterio-17-hydroxy-10,13-dimethyl-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one
Deuterated analytical reference standard
3-(Iodomethyl)heptane
Research reagent for organic synthesis
Ethyl 2-oxocyclohexanecarboxylate
research chemical intermediate
[3,6-bis(3-aminopropyl)-2,5-dihydroxy-2,5-dioxo-6-phosphono-1,4,2lambda5,5lambda5-dioxadiphosphinan-3-yl]phosphonic acid
IHJGHFNHGWYWJB-UHFFFAOYSA-N
C(CC1(OP(=O)(C(OP1(=O)O)(CCCN)P(=O)(O)O)O)P(=O)(O)O)CN